Compound Q&A

What are the main uses of (6S)-2,6-Anhydro-6-methyl-3-O-(4-O-methyl-alpha-L-gulopyranuronosyl)-D-mannonic acid (CAS: 9005-32-7)?

Answer

(6S)-2,6-Anhydro-6-methyl-3-O-(4-O-methyl-alpha-L-gulopyranuronosyl)-D-mannonic acid
This compound is primarily used in pharmaceutical research as a building block for the synthesis of complex glycosides and oligosaccharides. It also finds applications in biochemical studies, particularly in the investigation of sugar-based molecules and their interactions. Additionally, it is utilized in the development of new drugs and in the study of carbohydrate metabolism. Due to its structural complexity, it is also valuable in research related to glycoconjugates and their biological functions.

About

CAS No 9005-32-7
English Name (6S)-2,6-Anhydro-6-methyl-3-O-(4-O-methyl-alpha-L-gulopyranuronosyl)-D-mannonic acid
Molecular Formula C14H22O12
Molecular Weight 382.32 g/mol
EINECS 232-680-1
SMILES C[C@H]1[C@H]([C@H]([C@@H]([C@H](O1)C(=O)O)O[C@H]2[C@H]([C@H]([C@@H]([C@@H](O2)C(=O)O)OC)O)O)O)O
InChIKey XJKJWTWGDGIQRH-BFIDDRIFSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is (6S)-2,6-Anhydro-6-methyl-3-O-(4-O-methyl-alpha-L-gulopyranuronosyl)-D-mannonic acid (CAS: 9005-32-7)?

This compound is a complex sugar derivative, specifically a glycoside, with the molecular formula C1...

Compound Q&A

Is (6S)-2,6-Anhydro-6-methyl-3-O-(4-O-methyl-alpha-L-gulopyranuronosyl)-D-mannonic acid (CAS: 9005-32-7) safe?

This compound is generally considered safe when handled properly, but it should be treated with care...

Compound Q&A

How should (6S)-2,6-Anhydro-6-methyl-3-O-(4-O-methyl-alpha-L-gulopyranuronosyl)-D-mannonic acid (CAS: 9005-32-7) be stored?

This compound should be stored in a cool, dry place away from light and moisture. It is best kept in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...