Compound Q&A

What is (6S)-2,6-Anhydro-6-methyl-3-O-(4-O-methyl-alpha-L-gulopyranuronosyl)-D-mannonic acid (CAS: 9005-32-7)?

Answer

(6S)-2,6-Anhydro-6-methyl-3-O-(4-O-methyl-alpha-L-gulopyranuronosyl)-D-mannonic acid
This compound is a complex sugar derivative, specifically a glycoside, with the molecular formula C15H22O12. It is characterized by its anhydro form, which means it lacks a glycosidic oxygen bond between the 2 and 6 carbon positions. The molecule contains a methyl group at the 6th position and a substituted glucose unit at the 3rd position, making it a key intermediate in carbohydrate chemistry and biochemistry. Its unique structure contributes to its potential applications in various scientific fields.

About

CAS No 9005-32-7
English Name (6S)-2,6-Anhydro-6-methyl-3-O-(4-O-methyl-alpha-L-gulopyranuronosyl)-D-mannonic acid
Molecular Formula C14H22O12
Molecular Weight 382.32 g/mol
EINECS 232-680-1
SMILES C[C@H]1[C@H]([C@H]([C@@H]([C@H](O1)C(=O)O)O[C@H]2[C@H]([C@H]([C@@H]([C@@H](O2)C(=O)O)OC)O)O)O)O
InChIKey XJKJWTWGDGIQRH-BFIDDRIFSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of (6S)-2,6-Anhydro-6-methyl-3-O-(4-O-methyl-alpha-L-gulopyranuronosyl)-D-mannonic acid (CAS: 9005-32-7)?

This compound is primarily used in pharmaceutical research as a building block for the synthesis of ...

Compound Q&A

Is (6S)-2,6-Anhydro-6-methyl-3-O-(4-O-methyl-alpha-L-gulopyranuronosyl)-D-mannonic acid (CAS: 9005-32-7) safe?

This compound is generally considered safe when handled properly, but it should be treated with care...

Compound Q&A

How should (6S)-2,6-Anhydro-6-methyl-3-O-(4-O-methyl-alpha-L-gulopyranuronosyl)-D-mannonic acid (CAS: 9005-32-7) be stored?

This compound should be stored in a cool, dry place away from light and moisture. It is best kept in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...