Compound Q&A

Is 6-Fluoro-2-chromanecarboxylic acid (CAS: 99199-60-7) safe?

Answer

6-Fluoro-2-chromanecarboxylic acid
6-Fluoro-2-chromanecarboxylic acid (CAS: 99199-60-7) is generally considered safe when handled properly, but it requires standard laboratory precautions. It is advisable to use personal protective equipment (PPE) such as gloves and goggles, and to ensure proper ventilation to minimize exposure. Safety data sheets (SDS) should be consulted for detailed handling and disposal guidelines.

About

CAS No 99199-60-7
English Name 6-Fluoro-2-chromanecarboxylic acid
Molecular Formula C10H9FO3
Molecular Weight 196.18 g/mol
SMILES C1CC2=C(C=CC(=C2)F)OC1C(=O)O
InChIKey ZNJANLXCXMVFFI-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 6-Fluoro-2-chromanecarboxylic acid (CAS: 99199-60-7)?

6-Fluoro-2-chromanecarboxylic acid (CAS: 99199-60-7) is an organic compound with the chemical formul...

Compound Q&A

What are the main uses of 6-Fluoro-2-chromanecarboxylic acid (CAS: 99199-60-7)?

6-Fluoro-2-chromanecarboxylic acid (CAS: 99199-60-7) is primarily used in pharmaceutical research fo...

Compound Q&A

How should 6-Fluoro-2-chromanecarboxylic acid (CAS: 99199-60-7) be stored?

6-Fluoro-2-chromanecarboxylic acid (CAS: 99199-60-7) should be stored in a cool, dry, and well-venti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...