Compound Q&A

What is 6-Fluoro-2-chromanecarboxylic acid (CAS: 99199-60-7)?

Answer

6-Fluoro-2-chromanecarboxylic acid
6-Fluoro-2-chromanecarboxylic acid (CAS: 99199-60-7) is an organic compound with the chemical formula C10H7FO3. It belongs to the class of chromanecarboxylic acids and contains a fluoro group at the 6th position. This compound is characterized by its potential use in chemical synthesis and its unique reactivity due to the presence of both a fluorine atom and a carboxylic acid group.

About

CAS No 99199-60-7
English Name 6-Fluoro-2-chromanecarboxylic acid
Molecular Formula C10H9FO3
Molecular Weight 196.18 g/mol
SMILES C1CC2=C(C=CC(=C2)F)OC1C(=O)O
InChIKey ZNJANLXCXMVFFI-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 6-Fluoro-2-chromanecarboxylic acid (CAS: 99199-60-7)?

6-Fluoro-2-chromanecarboxylic acid (CAS: 99199-60-7) is primarily used in pharmaceutical research fo...

Compound Q&A

Is 6-Fluoro-2-chromanecarboxylic acid (CAS: 99199-60-7) safe?

6-Fluoro-2-chromanecarboxylic acid (CAS: 99199-60-7) is generally considered safe when handled prope...

Compound Q&A

How should 6-Fluoro-2-chromanecarboxylic acid (CAS: 99199-60-7) be stored?

6-Fluoro-2-chromanecarboxylic acid (CAS: 99199-60-7) should be stored in a cool, dry, and well-venti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...