Compound Q&A

How should Varenicline Tartrate (CAS: 375815-87-5) be stored?

Answer

Varenicline Tartrate
Varenicline Tartrate (CAS: 375815-87-5) should be stored in a cool, dry place away from direct light. It is typically kept at a temperature between 15°C to 25°C (59°F to 77°F) and in airtight containers to prevent moisture exposure. Proper storage ensures the stability and efficacy of the compound over time.

About

English Name Varenicline Tartrate
Molecular Formula C17H19N3O6
Molecular Weight 361.35 g/mol
SMILES C1C2CNCC1C3=CC4=NC=CN=C4C=C23.C(C(C(=O)O)O)(C(=O)O)O
InChIKey TWYFGYXQSYOKLK-CYUSMAIQSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is Varenicline Tartrate (CAS: 375815-87-5)?

Varenicline Tartrate (CAS: 375815-87-5) is a pharmaceutical compound used primarily in smoking cessa...

Compound Q&A

What are the main uses of Varenicline Tartrate (CAS: 375815-87-5)?

Varenicline Tartrate (CAS: 375815-87-5) is mainly used in pharmaceuticals for smoking cessation ther...

Compound Q&A

Is Varenicline Tartrate (CAS: 375815-87-5) safe?

Varenicline Tartrate (CAS: 375815-87-5) is generally considered safe when used as directed in medica...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...