Compound Q&A

What are the main uses of 1-Bromopyrene (CAS: 1714-29-0)?

Answer

1-Bromopyrene
1-Bromopyrene is primarily used in pharmaceutical research as a building block for drug development. It also serves as an industrial chemical in the production of dyes and materials. Additionally, it is employed in scientific studies to investigate aromatic compounds and their reactivity. Due to its bromine functionality, it may act as a brominating agent in synthetic processes.

About

CAS No 1714-29-0
English Name 1-Bromopyrene
Molecular Formula C16H9Br
Molecular Weight 281.152 g/mol
SMILES C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)Br
InChIKey HYGLETVERPVXOS-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 1-Bromopyrene (CAS: 1714-29-0)?

1-Bromopyrene is an aromatic hydrocarbon derivative with the chemical formula C14H9Br. It is a bromi...

Compound Q&A

Is 1-Bromopyrene (CAS: 1714-29-0) safe?

1-Bromopyrene is classified as a hazardous chemical due to potential toxicity. Handling requires pro...

Compound Q&A

How should 1-Bromopyrene (CAS: 1714-29-0) be stored?

1-Bromopyrene should be stored in a cool, dry, and dark place to maintain stability. Keep in a seale...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...