Compound Q&A

What is 1-Bromopyrene (CAS: 1714-29-0)?

Answer

1-Bromopyrene
1-Bromopyrene is an aromatic hydrocarbon derivative with the chemical formula C14H9Br. It is a brominated pyrene compound, known for its unique molecular structure and chemical properties. This substance is typically a solid at room temperature and exhibits low solubility in water. Its characteristics include potential reactivity and use as an intermediate in organic synthesis.

About

CAS No 1714-29-0
English Name 1-Bromopyrene
Molecular Formula C16H9Br
Molecular Weight 281.15 g/mol
SMILES C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)Br
InChIKey HYGLETVERPVXOS-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 1-Bromopyrene (CAS: 1714-29-0)?

1-Bromopyrene is primarily used in pharmaceutical research as a building block for drug development....

Compound Q&A

Is 1-Bromopyrene (CAS: 1714-29-0) safe?

1-Bromopyrene is classified as a hazardous chemical due to potential toxicity. Handling requires pro...

Compound Q&A

How should 1-Bromopyrene (CAS: 1714-29-0) be stored?

1-Bromopyrene should be stored in a cool, dry, and dark place to maintain stability. Keep in a seale...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...