Compound Q&A

What are the main uses of 3-(Dihydroxyboryl)benzoic acid (CAS: 25487-66-5)?

Answer

3-(Dihydroxyboryl)benzoic acid
3-(Dihydroxyboryl)benzoic acid (CAS: 25487-66-5) is widely utilized in pharmaceutical research for drug development and as a precursor in the synthesis of various boric acid derivatives. It also finds applications in the chemical industry for creating functional materials and in organic chemistry for catalytic processes. Additionally, it is used in research involving borylation reactions and as a component in certain specialty chemicals.

About

CAS No 25487-66-5
English Name 3-(Dihydroxyboryl)benzoic acid
Molecular Formula C7H7BO4
Molecular Weight 165.94 g/mol
SMILES B(C1=CC(=CC=C1)C(=O)O)(O)O
InChIKey DBVFWZMQJQMJCB-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 3-(Dihydroxyboryl)benzoic acid (CAS: 25487-66-5)?

3-(Dihydroxyboryl)benzoic acid, with the CAS number 25487-66-5, is an organic compound containing a ...

Compound Q&A

Is 3-(Dihydroxyboryl)benzoic acid (CAS: 25487-66-5) safe?

3-(Dihydroxyboryl)benzoic acid (CAS: 25487-66-5) is generally considered safe when handled properly....

Compound Q&A

How should 3-(Dihydroxyboryl)benzoic acid (CAS: 25487-66-5) be stored?

3-(Dihydroxyboryl)benzoic acid (CAS: 25487-66-5) should be stored in a cool, dry, and well-ventilate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...