Compound Q&A

What is 3-(Dihydroxyboryl)benzoic acid (CAS: 25487-66-5)?

Answer

3-(Dihydroxyboryl)benzoic acid
3-(Dihydroxyboryl)benzoic acid, with the CAS number 25487-66-5, is an organic compound containing a boryl group attached to a benzene ring. It is also known as 3-benzoylboronic acid and has the chemical formula C8H10B2O5. This compound is characterized by its acidic properties due to the carboxylic acid group and its reactivity due to the boryl functionality. It is commonly used as a building block in organic synthesis and is relevant in the development of pharmaceutical and industrial products.

About

CAS No 25487-66-5
English Name 3-(Dihydroxyboryl)benzoic acid
Molecular Formula C7H7BO4
Molecular Weight 165.94 g/mol
SMILES B(C1=CC(=CC=C1)C(=O)O)(O)O
InChIKey DBVFWZMQJQMJCB-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 3-(Dihydroxyboryl)benzoic acid (CAS: 25487-66-5)?

3-(Dihydroxyboryl)benzoic acid (CAS: 25487-66-5) is widely utilized in pharmaceutical research for d...

Compound Q&A

Is 3-(Dihydroxyboryl)benzoic acid (CAS: 25487-66-5) safe?

3-(Dihydroxyboryl)benzoic acid (CAS: 25487-66-5) is generally considered safe when handled properly....

Compound Q&A

How should 3-(Dihydroxyboryl)benzoic acid (CAS: 25487-66-5) be stored?

3-(Dihydroxyboryl)benzoic acid (CAS: 25487-66-5) should be stored in a cool, dry, and well-ventilate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...