Compound Q&A

How should 2,2-Dimethoxy-2-Phenylacetophenone (CAS: 24650-42-8) be stored?

Answer

2,2-Dimethoxy-2-Phenylacetophenone
2,2-Dimethoxy-2-Phenylacetophenone (CAS: 24650-42-8) should be stored in a cool, dry, and dark place to maintain stability. Keep it in a sealed container away from moisture and light, and ensure it is stored under inert gas conditions if required. Proper storage prevents degradation and ensures compliance with chemical safety standards for long-term use.

About

CAS No 24650-42-8
English Name 2,2-Dimethoxy-2-Phenylacetophenone
Molecular Formula C16H16O3
Molecular Weight 256.3 g/mol
SMILES COC(OC)(C(=O)c1ccccc1)c2ccccc2
InChIKey KWVGIHKZDCUPEU-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 2,2-Dimethoxy-2-Phenylacetophenone (CAS: 24650-42-8)?

2,2-Dimethoxy-2-Phenylacetophenone (CAS: 24650-42-8) is an organic compound with the chemical formul...

Compound Q&A

What are the main uses of 2,2-Dimethoxy-2-Phenylacetophenone (CAS: 24650-42-8)?

2,2-Dimethoxy-2-Phenylacetophenone (CAS: 24650-42-8) is primarily utilized in pharmaceuticals for dr...

Compound Q&A

Is 2,2-Dimethoxy-2-Phenylacetophenone (CAS: 24650-42-8) safe?

2,2-Dimethoxy-2-Phenylacetophenone (CAS: 24650-42-8) is generally considered safe when handled prope...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...