Compound Q&A

What are the main uses of 2,2-Dimethoxy-2-Phenylacetophenone (CAS: 24650-42-8)?

Answer

2,2-Dimethoxy-2-Phenylacetophenone
2,2-Dimethoxy-2-Phenylacetophenone (CAS: 24650-42-8) is primarily utilized in pharmaceuticals for drug development, in industrial chemistry as a reagent for functional group modifications, and in research for creating complex organic molecules. It also finds applications in fragrance compounds and as a key component in synthesizing bioactive molecules due to its reactivity and structural adaptability.

About

CAS No 24650-42-8
English Name 2,2-Dimethoxy-2-Phenylacetophenone
Molecular Formula C16H16O3
Molecular Weight 256.3 g/mol
SMILES COC(OC)(C(=O)c1ccccc1)c2ccccc2
InChIKey KWVGIHKZDCUPEU-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 2,2-Dimethoxy-2-Phenylacetophenone (CAS: 24650-42-8)?

2,2-Dimethoxy-2-Phenylacetophenone (CAS: 24650-42-8) is an organic compound with the chemical formul...

Compound Q&A

Is 2,2-Dimethoxy-2-Phenylacetophenone (CAS: 24650-42-8) safe?

2,2-Dimethoxy-2-Phenylacetophenone (CAS: 24650-42-8) is generally considered safe when handled prope...

Compound Q&A

How should 2,2-Dimethoxy-2-Phenylacetophenone (CAS: 24650-42-8) be stored?

2,2-Dimethoxy-2-Phenylacetophenone (CAS: 24650-42-8) should be stored in a cool, dry, and dark place...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...