Compound Q&A

What are the main uses of 1,6-diethyl 2,5-dibromohexanedioate (CAS: 869-10-3)?

Answer

1,6-diethyl 2,5-dibromohexanedioate
1,6-diethyl 2,5-dibromohexanedioate (CAS: 869-10-3) is primarily used in pharmaceutical research as a building block for drug development. It also finds applications in industrial chemistry for the synthesis of various organic compounds. Additionally, it is used in organic synthesis and as an intermediate in the production of specialty chemicals and materials.

About

CAS No 869-10-3
English Name 1,6-diethyl 2,5-dibromohexanedioate
Molecular Formula C10H16Br2O4
Molecular Weight 360.04 g/mol
SMILES CCOC(=O)C(Br)CCC(Br)C(=O)OCC
InChIKey UBCNJHBDCUBIPB-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 1,6-diethyl 2,5-dibromohexanedioate (CAS: 869-10-3)?

1,6-diethyl 2,5-dibromohexanedioate (CAS: 869-10-3) is an organic compound with the chemical formula...

Compound Q&A

Is 1,6-diethyl 2,5-dibromohexanedioate (CAS: 869-10-3) safe?

1,6-diethyl 2,5-dibromohexanedioate (CAS: 869-10-3) is considered hazardous due to its bromine conte...

Compound Q&A

How should 1,6-diethyl 2,5-dibromohexanedioate (CAS: 869-10-3) be stored?

1,6-diethyl 2,5-dibromohexanedioate (CAS: 869-10-3) should be stored in a cool, dry, and well-ventil...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...