Compound Q&A

What are the main uses of 3-[3-(Trifluoromethyl)phenyl]acrylic acid (CAS: 779-89-5)?

Answer

3-[3-(Trifluoromethyl)phenyl]acrylic acid
3-[3-(Trifluoromethyl)phenyl]acrylic acid is widely used in pharmaceuticals as a key intermediate in drug synthesis. It also finds applications in industrial chemistry for polymer production and in research for developing new materials. Its unique chemical structure makes it valuable in creating compounds with specific biological and chemical properties.

About

CAS No 779-89-5
English Name 3-[3-(Trifluoromethyl)phenyl]acrylic acid
Molecular Formula C10H7F3O2
Molecular Weight 216.16 g/mol
SMILES C1=CC(=CC(=C1)C(F)(F)F)C=CC(=O)O
InChIKey KSBWHDDGWSYETA-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 3-[3-(Trifluoromethyl)phenyl]acrylic acid (CAS: 779-89-5)?

3-[3-(Trifluoromethyl)phenyl]acrylic acid is an organic compound with the CAS number 779-89-5. It co...

Compound Q&A

Is 3-[3-(Trifluoromethyl)phenyl]acrylic acid (CAS: 779-89-5) safe?

3-[3-(Trifluoromethyl)phenyl]acrylic acid is generally considered safe when handled properly. Howeve...

Compound Q&A

How should 3-[3-(Trifluoromethyl)phenyl]acrylic acid (CAS: 779-89-5) be stored?

3-[3-(Trifluoromethyl)phenyl]acrylic acid should be stored in a cool, dry, and well-ventilated place...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...