Compound Q&A

What is 3-[3-(Trifluoromethyl)phenyl]acrylic acid (CAS: 779-89-5)?

Answer

3-[3-(Trifluoromethyl)phenyl]acrylic acid
3-[3-(Trifluoromethyl)phenyl]acrylic acid is an organic compound with the CAS number 779-89-5. It contains a trifluoromethyl group attached to a phenyl ring, which is then connected to an acrylic acid moiety. This compound is known for its stability and reactivity, and it is commonly used in various chemical applications due to its functional groups and structural versatility.

About

CAS No 779-89-5
English Name 3-[3-(Trifluoromethyl)phenyl]acrylic acid
Molecular Formula C10H7F3O2
Molecular Weight 216.16 g/mol
SMILES C1=CC(=CC(=C1)C(F)(F)F)C=CC(=O)O
InChIKey KSBWHDDGWSYETA-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 3-[3-(Trifluoromethyl)phenyl]acrylic acid (CAS: 779-89-5)?

3-[3-(Trifluoromethyl)phenyl]acrylic acid is widely used in pharmaceuticals as a key intermediate in...

Compound Q&A

Is 3-[3-(Trifluoromethyl)phenyl]acrylic acid (CAS: 779-89-5) safe?

3-[3-(Trifluoromethyl)phenyl]acrylic acid is generally considered safe when handled properly. Howeve...

Compound Q&A

How should 3-[3-(Trifluoromethyl)phenyl]acrylic acid (CAS: 779-89-5) be stored?

3-[3-(Trifluoromethyl)phenyl]acrylic acid should be stored in a cool, dry, and well-ventilated place...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...