Compound Q&A

How should 1,1,2,2,3,3,4,4,4-Nonafluoro-1-butanesulfonyl fluoride (CAS: 375-72-4) be stored?

Answer

1,1,2,2,3,3,4,4,4-Nonafluoro-1-butanesulfonyl fluoride
1,1,2,2,3,3,4,4,4-Nonafluoro-1-butanesulfonyl fluoride (CAS: 375-72-4) should be stored in a cool, dry, and well-ventilated area away from direct sunlight. It is typically kept in sealed, inert gas-filled containers to prevent moisture and air exposure. Storage conditions should maintain a temperature below 25°C and ensure low humidity to preserve its chemical stability and integrity.

About

CAS No 375-72-4
English Name 1,1,2,2,3,3,4,4,4-Nonafluoro-1-butanesulfonyl fluoride
Molecular Formula C4F10O2S
Molecular Weight 302.089 g/mol
SMILES C(C(C(F)(F)S(=O)(=O)F)(F)F)(C(F)(F)F)(F)F
InChIKey LUYQYZLEHLTPBH-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 1,1,2,2,3,3,4,4,4-Nonafluoro-1-butanesulfonyl fluoride (CAS: 375-72-4)?

1,1,2,2,3,3,4,4,4-Nonafluoro-1-butanesulfonyl fluoride (CAS: 375-72-4) is a highly fluorinated organ...

Compound Q&A

What are the main uses of 1,1,2,2,3,3,4,4,4-Nonafluoro-1-butanesulfonyl fluoride (CAS: 375-72-4)?

1,1,2,2,3,3,4,4,4-Nonafluoro-1-butanesulfonyl fluoride (CAS: 375-72-4) is primarily used in the synt...

Compound Q&A

Is 1,1,2,2,3,3,4,4,4-Nonafluoro-1-butanesulfonyl fluoride (CAS: 375-72-4) safe?

1,1,2,2,3,3,4,4,4-Nonafluoro-1-butanesulfonyl fluoride (CAS: 375-72-4) is considered toxic when inha...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...