Compound Q&A

What is 1,1,2,2,3,3,4,4,4-Nonafluoro-1-butanesulfonyl fluoride (CAS: 375-72-4)?

Answer

1,1,2,2,3,3,4,4,4-Nonafluoro-1-butanesulfonyl fluoride
1,1,2,2,3,3,4,4,4-Nonafluoro-1-butanesulfonyl fluoride (CAS: 375-72-4) is a highly fluorinated organosulfur compound. Its chemical formula is C4F9SO2F, and it exhibits strong hydrophobic and chemical inertness properties. This compound is known for its stability and resistance to thermal and chemical degradation, making it suitable for specialized applications in chemical synthesis and materials science.

About

CAS No 375-72-4
English Name 1,1,2,2,3,3,4,4,4-Nonafluoro-1-butanesulfonyl fluoride
Molecular Formula C4F10O2S
Molecular Weight 302.09 g/mol
SMILES C(C(C(F)(F)S(=O)(=O)F)(F)F)(C(F)(F)F)(F)F
InChIKey LUYQYZLEHLTPBH-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 1,1,2,2,3,3,4,4,4-Nonafluoro-1-butanesulfonyl fluoride (CAS: 375-72-4)?

1,1,2,2,3,3,4,4,4-Nonafluoro-1-butanesulfonyl fluoride (CAS: 375-72-4) is primarily used in the synt...

Compound Q&A

Is 1,1,2,2,3,3,4,4,4-Nonafluoro-1-butanesulfonyl fluoride (CAS: 375-72-4) safe?

1,1,2,2,3,3,4,4,4-Nonafluoro-1-butanesulfonyl fluoride (CAS: 375-72-4) is considered toxic when inha...

Compound Q&A

How should 1,1,2,2,3,3,4,4,4-Nonafluoro-1-butanesulfonyl fluoride (CAS: 375-72-4) be stored?

1,1,2,2,3,3,4,4,4-Nonafluoro-1-butanesulfonyl fluoride (CAS: 375-72-4) should be stored in a cool, d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...