Compound Q&A

What are the main uses of 2-(2-Aminothiazol-4-yl)-2-(methoxyimino)acetic acid (CAS: 65872-41-5)?

Answer

2-(2-Aminothiazol-4-yl)-2-(methoxyimino)acetic acid
This compound is primarily used in pharmaceutical research as a building block for the synthesis of various drugs. It also finds applications in organic chemistry for creating derivatives with enhanced biological activity. Additionally, it may be used in industrial processes and as a reagent in chemical analysis due to its versatile functional groups and reactivity.

About

CAS No 65872-41-5
English Name 2-(2-Aminothiazol-4-yl)-2-(methoxyimino)acetic acid
Molecular Formula C6H7N3O3S
Molecular Weight 201.21 g/mol
SMILES O=C(O)/C(C1=CSC(N)=N1)=N/OC
InChIKey NLARCUDOUOQRPB-RUDMXATFSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 2-(2-Aminothiazol-4-yl)-2-(methoxyimino)acetic acid (CAS: 65872-41-5)?

2-(2-Aminothiazol-4-yl)-2-(methoxyimino)acetic acid (CAS: 65872-41-5) is a thiazole-containing organ...

Compound Q&A

Is 2-(2-Aminothiazol-4-yl)-2-(methoxyimino)acetic acid (CAS: 65872-41-5) safe?

2-(2-Aminothiazol-4-yl)-2-(methoxyimino)acetic acid (CAS: 65872-41-5) is generally considered safe w...

Compound Q&A

How should 2-(2-Aminothiazol-4-yl)-2-(methoxyimino)acetic acid (CAS: 65872-41-5) be stored?

To ensure stability and safety, 2-(2-Aminothiazol-4-yl)-2-(methoxyimino)acetic acid (CAS: 65872-41-5...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...