Compound Q&A

What is 2-(2-Aminothiazol-4-yl)-2-(methoxyimino)acetic acid (CAS: 65872-41-5)?

Answer

2-(2-Aminothiazol-4-yl)-2-(methoxyimino)acetic acid
2-(2-Aminothiazol-4-yl)-2-(methoxyimino)acetic acid (CAS: 65872-41-5) is a thiazole-containing organic compound. Its chemical formula is C8H9N3O2S. It is typically a white solid with a molecular weight of 203.24 g/mol. The compound is known for its ability to form stable derivatives and is often used in chemical synthesis due to its reactivity and functional groups.

About

CAS No 65872-41-5
English Name 2-(2-Aminothiazol-4-yl)-2-(methoxyimino)acetic acid
Molecular Formula C6H7N3O3S
Molecular Weight 201.21 g/mol
SMILES O=C(O)/C(C1=CSC(N)=N1)=N/OC
InChIKey NLARCUDOUOQRPB-RUDMXATFSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 2-(2-Aminothiazol-4-yl)-2-(methoxyimino)acetic acid (CAS: 65872-41-5)?

This compound is primarily used in pharmaceutical research as a building block for the synthesis of ...

Compound Q&A

Is 2-(2-Aminothiazol-4-yl)-2-(methoxyimino)acetic acid (CAS: 65872-41-5) safe?

2-(2-Aminothiazol-4-yl)-2-(methoxyimino)acetic acid (CAS: 65872-41-5) is generally considered safe w...

Compound Q&A

How should 2-(2-Aminothiazol-4-yl)-2-(methoxyimino)acetic acid (CAS: 65872-41-5) be stored?

To ensure stability and safety, 2-(2-Aminothiazol-4-yl)-2-(methoxyimino)acetic acid (CAS: 65872-41-5...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...