Compound Q&A

Is Ginkgolide C (CAS: 15291-76-6) safe?

Answer

Ginkgolide C
Ginkgolide C is generally considered safe when used in appropriate amounts and under proper supervision. However, like other ginkgolides, it may cause mild side effects such as gastrointestinal discomfort or allergic reactions in some individuals. Safety guidelines recommend consulting a healthcare professional before use and following recommended dosages to minimize risks.

About

CAS No 15291-76-6
English Name Ginkgolide C
Molecular Formula C20H24O11
Molecular Weight 440.4 g/mol
SMILES O=C1O[C@@H]2[C@@]([C@@H]1C)(O)[C@@]13[C@]4([C@@H]2O)[C@H](OC3=O)[C@@H]([C@H]([C@@]24[C@H](O1)OC(=O)[C@@H]2O)C(C)(C)C)O
InChIKey AMOGMTLMADGEOQ-PYLUGNSCSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is Ginkgolide C (CAS: 15291-76-6)?

Ginkgolide C is a natural compound derived from the Ginkgo biloba tree, known for its potent pharmac...

Compound Q&A

What are the main uses of Ginkgolide C (CAS: 15291-76-6)?

Ginkgolide C is primarily used in pharmaceutical research for its potential therapeutic applications...

Compound Q&A

How should Ginkgolide C (CAS: 15291-76-6) be stored?

Ginkgolide C should be stored in a cool, dry, and dark environment to maintain its stability and pot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...