Compound Q&A

What is Ginkgolide C (CAS: 15291-76-6)?

Answer

Ginkgolide C
Ginkgolide C is a natural compound derived from the Ginkgo biloba tree, known for its potent pharmacological properties. It has the chemical formula C20H28O6 and is a bicyclic diterpene lactone. Ginkgolide C is characterized by its ability to inhibit phosphodiesterase enzymes and has been studied for its potential effects on cognitive function and vascular health.

About

CAS No 15291-76-6
English Name Ginkgolide C
Molecular Formula C20H24O11
Molecular Weight 440.4 g/mol
SMILES O=C1O[C@@H]2[C@@]([C@@H]1C)(O)[C@@]13[C@]4([C@@H]2O)[C@H](OC3=O)[C@@H]([C@H]([C@@]24[C@H](O1)OC(=O)[C@@H]2O)C(C)(C)C)O
InChIKey AMOGMTLMADGEOQ-PYLUGNSCSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of Ginkgolide C (CAS: 15291-76-6)?

Ginkgolide C is primarily used in pharmaceutical research for its potential therapeutic applications...

Compound Q&A

Is Ginkgolide C (CAS: 15291-76-6) safe?

Ginkgolide C is generally considered safe when used in appropriate amounts and under proper supervis...

Compound Q&A

How should Ginkgolide C (CAS: 15291-76-6) be stored?

Ginkgolide C should be stored in a cool, dry, and dark environment to maintain its stability and pot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...