Compound Q&A

Is 4-Nitrophthalic acid (CAS: 610-27-5) safe?

Answer

4-Nitrophthalic acid
4-Nitrophthalic acid is generally considered safe when handled properly, but it may cause skin and eye irritation. It is important to follow safety guidelines, such as using personal protective equipment and working in a well-ventilated area. Safety standards typically classify it as a moderately hazardous chemical, requiring careful handling to prevent exposure and ensure proper disposal.

About

CAS No 610-27-5
English Name 4-Nitrophthalic acid
Molecular Formula C8H5NO6
Molecular Weight 211.13 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)C(=O)O
InChIKey SLBQXWXKPNIVSQ-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 4-Nitrophthalic acid (CAS: 610-27-5)?

4-Nitrophthalic acid is an organic compound with the chemical formula C8H5NO5. It is a derivative of...

Compound Q&A

What are the main uses of 4-Nitrophthalic acid (CAS: 610-27-5)?

4-Nitrophthalic acid is primarily used in the synthesis of pharmaceuticals and dyes. It serves as an...

Compound Q&A

How should 4-Nitrophthalic acid (CAS: 610-27-5) be stored?

4-Nitrophthalic acid should be stored in a cool, dry, and well-ventilated place, away from light. It...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...