Compound Q&A

What are the main uses of 4-Nitrophthalic acid (CAS: 610-27-5)?

Answer

4-Nitrophthalic acid
4-Nitrophthalic acid is primarily used in the synthesis of pharmaceuticals and dyes. It serves as an intermediate in the production of various organic compounds, including some drugs and pigments. Additionally, it finds applications in research settings for chemical reactions and as a component in industrial processes involving acid catalysts and functional group modifications.

About

CAS No 610-27-5
English Name 4-Nitrophthalic acid
Molecular Formula C8H5NO6
Molecular Weight 211.13 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)C(=O)O
InChIKey SLBQXWXKPNIVSQ-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 4-Nitrophthalic acid (CAS: 610-27-5)?

4-Nitrophthalic acid is an organic compound with the chemical formula C8H5NO5. It is a derivative of...

Compound Q&A

Is 4-Nitrophthalic acid (CAS: 610-27-5) safe?

4-Nitrophthalic acid is generally considered safe when handled properly, but it may cause skin and e...

Compound Q&A

How should 4-Nitrophthalic acid (CAS: 610-27-5) be stored?

4-Nitrophthalic acid should be stored in a cool, dry, and well-ventilated place, away from light. It...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...