Compound Q&A

How should Aripiprazole EP Impurity B HCl (CAS: 119532-26-2) be stored?

Answer

Aripiprazole EP Impurity B HCl (Aripiprazole USP Related Compound C)
Aripiprazole EP Impurity B HCl (CAS: 119532-26-2) should be stored in a cool, dry, and dark place, preferably at 20-25°C. It should be kept in a sealed container away from moisture and light to maintain stability. Proper storage is essential to prevent degradation and ensure its effectiveness in analytical applications.

About

English Name Aripiprazole EP Impurity B HCl (Aripiprazole USP Related Compound C)
Molecular Formula C10H13Cl3N2
Molecular Weight 267.58699999999993 g/mol
SMILES C1CN(CCN1)C2=C(C(=CC=C2)Cl)Cl.Cl
InChIKey CYQFNNSFAGXCEC-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is Aripiprazole EP Impurity B HCl (CAS: 119532-26-2)?

Aripiprazole EP Impurity B HCl (CAS: 119532-26-2) is a hydrochloride salt of a specific impurity fou...

Compound Q&A

What are the main uses of Aripiprazole EP Impurity B HCl (CAS: 119532-26-2)?

Aripiprazole EP Impurity B HCl (CAS: 119532-26-2) is mainly used in pharmaceutical research and qual...

Compound Q&A

Is Aripiprazole EP Impurity B HCl (CAS: 119532-26-2) safe?

Aripiprazole EP Impurity B HCl (CAS: 119532-26-2) is generally considered safe when handled properly...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...