Compound Q&A

What are the main uses of Aripiprazole EP Impurity B HCl (CAS: 119532-26-2)?

Answer

Aripiprazole EP Impurity B HCl (Aripiprazole USP Related Compound C)
Aripiprazole EP Impurity B HCl (CAS: 119532-26-2) is mainly used in pharmaceutical research and quality assurance to identify and quantify impurities in aripiprazole. It plays a critical role in drug development, regulatory compliance, and analytical testing to meet USP (United States Pharmacopoeia) standards for pharmaceutical purity.

About

English Name Aripiprazole EP Impurity B HCl (Aripiprazole USP Related Compound C)
Molecular Formula C10H13Cl3N2
Molecular Weight 267.59 g/mol
SMILES C1CN(CCN1)C2=C(C(=CC=C2)Cl)Cl.Cl
InChIKey CYQFNNSFAGXCEC-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is Aripiprazole EP Impurity B HCl (CAS: 119532-26-2)?

Aripiprazole EP Impurity B HCl (CAS: 119532-26-2) is a hydrochloride salt of a specific impurity fou...

Compound Q&A

Is Aripiprazole EP Impurity B HCl (CAS: 119532-26-2) safe?

Aripiprazole EP Impurity B HCl (CAS: 119532-26-2) is generally considered safe when handled properly...

Compound Q&A

How should Aripiprazole EP Impurity B HCl (CAS: 119532-26-2) be stored?

Aripiprazole EP Impurity B HCl (CAS: 119532-26-2) should be stored in a cool, dry, and dark place, p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...