Compound Q&A

How should 2-Methyl-3,5-dinitrobenzamide (CAS: 148-01-6) be stored?

Answer

2-Methyl-3,5-dinitrobenzamide
2-Methyl-3,5-dinitrobenzamide should be stored in a cool, dry place away from light and moisture. It is typically kept in a sealed container to prevent exposure to air. Due to its chemical stability, it does not degrade easily under normal storage conditions, but proper handling is essential to maintain its integrity and ensure safety.

About

CAS No 148-01-6
English Name 2-Methyl-3,5-dinitrobenzamide
Molecular Formula C8H7N3O5
Molecular Weight 225.16 g/mol
SMILES CC1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(=O)N
InChIKey ZEFNOZRLAWVAQF-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 2-Methyl-3,5-dinitrobenzamide (CAS: 148-01-6)?

2-Methyl-3,5-dinitrobenzamide, with the CAS number 148-01-6, is an organic compound containing a ben...

Compound Q&A

What are the main uses of 2-Methyl-3,5-dinitrobenzamide (CAS: 148-01-6)?

2-Methyl-3,5-dinitrobenzamide is primarily used in pharmaceutical research as an intermediate in the...

Compound Q&A

Is 2-Methyl-3,5-dinitrobenzamide (CAS: 148-01-6) safe?

2-Methyl-3,5-dinitrobenzamide is considered hazardous due to its potential to cause irritation and t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...