Compound Q&A

What are the main uses of 2-Methyl-3,5-dinitrobenzamide (CAS: 148-01-6)?

Answer

2-Methyl-3,5-dinitrobenzamide
2-Methyl-3,5-dinitrobenzamide is primarily used in pharmaceutical research as an intermediate in the synthesis of certain drugs. It also finds applications in industrial chemistry for the production of dyes, pigments, and other specialty chemicals. Its chemical properties make it valuable in organic synthesis and for studying reaction mechanisms in research settings.

About

CAS No 148-01-6
English Name 2-Methyl-3,5-dinitrobenzamide
Molecular Formula C8H7N3O5
Molecular Weight 225.16 g/mol
SMILES CC1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(=O)N
InChIKey ZEFNOZRLAWVAQF-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 2-Methyl-3,5-dinitrobenzamide (CAS: 148-01-6)?

2-Methyl-3,5-dinitrobenzamide, with the CAS number 148-01-6, is an organic compound containing a ben...

Compound Q&A

Is 2-Methyl-3,5-dinitrobenzamide (CAS: 148-01-6) safe?

2-Methyl-3,5-dinitrobenzamide is considered hazardous due to its potential to cause irritation and t...

Compound Q&A

How should 2-Methyl-3,5-dinitrobenzamide (CAS: 148-01-6) be stored?

2-Methyl-3,5-dinitrobenzamide should be stored in a cool, dry place away from light and moisture. It...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...