Compound Q&A

What is Sunitinib (CAS: 557795-19-4)?

Answer

Sunitinib
Sunitinib is a multi-targeted tyrosine kinase inhibitor used in pharmaceutical applications. Its chemical formula is C19H22N4O4S, and it exhibits good solubility in DMSO and ethanol. It is known for its ability to inhibit various receptor tyrosine kinases, making it a valuable compound in drug development and research.

About

English Name Sunitinib
Molecular Formula C22H27FN4O2
Molecular Weight 398.48 g/mol
SMILES CCN(CC)CCNC(=O)c1c(C)[nH]c(/C=C/2\C(=O)Nc3ccc(F)cc23)c1C
InChIKey WINHZLLDWRZWRT-ATVHPVEESA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of Sunitinib (CAS: 557795-19-4)?

Sunitinib is primarily used in the treatment of certain cancers, including gastrointestinal stromal ...

Compound Q&A

Is Sunitinib (CAS: 557795-19-4) safe?

Sunitinib is generally considered safe when used under medical supervision, but it may cause side ef...

Compound Q&A

How should Sunitinib (CAS: 557795-19-4) be stored?

Sunitinib should be stored in a cool, dry place away from light. It is typically kept in a sealed co...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...