Compound Q&A

What are the main uses of 1,7-Bis(4-hydroxy-3-methoxyphenyl)-3,5-heptanedione (CAS: 36062-04-1)?

Answer

1,7-Bis(4-hydroxy-3-methoxyphenyl)-3,5-heptanedione
1,7-Bis(4-hydroxy-3-methoxyphenyl)-3,5-heptanedione (CAS: 36062-04-1) is primarily used in pharmaceutical research as a potential lead compound for drug development. It also finds applications in the synthesis of dyes and organic materials, and may be used in chemical research for its structural versatility and reactivity.

About

CAS No 36062-04-1
English Name 1,7-Bis(4-hydroxy-3-methoxyphenyl)-3,5-heptanedione
Molecular Formula C21H24O6
Molecular Weight 372.42 g/mol
SMILES COc1cc(CCC(=O)CC(=O)CCc2ccc(c(c2)OC)O)ccc1O
InChIKey LBTVHXHERHESKG-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 1,7-Bis(4-hydroxy-3-methoxyphenyl)-3,5-heptanedione (CAS: 36062-04-1)?

1,7-Bis(4-hydroxy-3-methoxyphenyl)-3,5-heptanedione is an organic compound with the CAS number 36062...

Compound Q&A

Is 1,7-Bis(4-hydroxy-3-methoxyphenyl)-3,5-heptanedione (CAS: 36062-04-1) safe?

1,7-Bis(4-hydroxy-3-methoxyphenyl)-3,5-heptanedione (CAS: 36062-04-1) is generally considered safe w...

Compound Q&A

How should 1,7-Bis(4-hydroxy-3-methoxyphenyl)-3,5-heptanedione (CAS: 36062-04-1) be stored?

1,7-Bis(4-hydroxy-3-methoxyphenyl)-3,5-heptanedione (CAS: 36062-04-1) should be stored in a cool, dr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...