Compound Q&A

What is 1,7-Bis(4-hydroxy-3-methoxyphenyl)-3,5-heptanedione (CAS: 36062-04-1)?

Answer

1,7-Bis(4-hydroxy-3-methoxyphenyl)-3,5-heptanedione
1,7-Bis(4-hydroxy-3-methoxyphenyl)-3,5-heptanedione is an organic compound with the CAS number 36062-04-1. It is a dihydroxy derivative of heptanedione, featuring two phenyl rings substituted with hydroxyl and methoxy groups. This compound is known for its aromatic structure and potential applications in various scientific fields.

About

CAS No 36062-04-1
English Name 1,7-Bis(4-hydroxy-3-methoxyphenyl)-3,5-heptanedione
Molecular Formula C21H24O6
Molecular Weight 372.42 g/mol
SMILES COc1cc(CCC(=O)CC(=O)CCc2ccc(c(c2)OC)O)ccc1O
InChIKey LBTVHXHERHESKG-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 1,7-Bis(4-hydroxy-3-methoxyphenyl)-3,5-heptanedione (CAS: 36062-04-1)?

1,7-Bis(4-hydroxy-3-methoxyphenyl)-3,5-heptanedione (CAS: 36062-04-1) is primarily used in pharmaceu...

Compound Q&A

Is 1,7-Bis(4-hydroxy-3-methoxyphenyl)-3,5-heptanedione (CAS: 36062-04-1) safe?

1,7-Bis(4-hydroxy-3-methoxyphenyl)-3,5-heptanedione (CAS: 36062-04-1) is generally considered safe w...

Compound Q&A

How should 1,7-Bis(4-hydroxy-3-methoxyphenyl)-3,5-heptanedione (CAS: 36062-04-1) be stored?

1,7-Bis(4-hydroxy-3-methoxyphenyl)-3,5-heptanedione (CAS: 36062-04-1) should be stored in a cool, dr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...