Compound Q&A

How should 3-(9H-Carbazol-9-yl)phenylboronic acid (CAS: 864377-33-3) be stored?

Answer

3-(9H-Carbazol-9-yl)phenylboronic acid
3-(9H-Carbazol-9-yl)phenylboronic acid should be stored in a cool, dry place away from light. It is best kept in a sealed container at a temperature below 25°C and with low humidity to prevent degradation. Avoid exposure to moisture and air to maintain its stability and effectiveness over time.

About

English Name 3-(9H-Carbazol-9-yl)phenylboronic acid
Molecular Formula C18H14BNO2
Molecular Weight 287.13 g/mol
SMILES B(C1=CC(=CC=C1)N2C3=CC=CC=C3C4=CC=CC=C42)(O)O
InChIKey IDQUIFLAFFZYEX-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is 3-(9H-Carbazol-9-yl)phenylboronic acid (CAS: 864377-33-3)?

3-(9H-Carbazol-9-yl)phenylboronic acid is a boronic acid derivative containing a carbazole ring. Its...

Compound Q&A

What are the main uses of 3-(9H-Carbazol-9-yl)phenylboronic acid (CAS: 864377-33-3)?

3-(9H-Carbazol-9-yl)phenylboronic acid is primarily used in pharmaceutical research for the synthesi...

Compound Q&A

Is 3-(9H-Carbazol-9-yl)phenylboronic acid (CAS: 864377-33-3) safe?

3-(9H-Carbazol-9-yl)phenylboronic acid is generally considered safe when handled properly. However, ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...