Compound Q&A

What are the main uses of 3-(9H-Carbazol-9-yl)phenylboronic acid (CAS: 864377-33-3)?

Answer

3-(9H-Carbazol-9-yl)phenylboronic acid
3-(9H-Carbazol-9-yl)phenylboronic acid is primarily used in pharmaceutical research for the synthesis of drug molecules, particularly those with biological activity. It also finds applications in materials science for creating functional polymers and organic compounds. Additionally, it is used in chemical research for coupling reactions and in the development of organic ligands for catalytic processes.

About

English Name 3-(9H-Carbazol-9-yl)phenylboronic acid
Molecular Formula C18H14BNO2
Molecular Weight 287.13 g/mol
SMILES B(C1=CC(=CC=C1)N2C3=CC=CC=C3C4=CC=CC=C42)(O)O
InChIKey IDQUIFLAFFZYEX-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is 3-(9H-Carbazol-9-yl)phenylboronic acid (CAS: 864377-33-3)?

3-(9H-Carbazol-9-yl)phenylboronic acid is a boronic acid derivative containing a carbazole ring. Its...

Compound Q&A

Is 3-(9H-Carbazol-9-yl)phenylboronic acid (CAS: 864377-33-3) safe?

3-(9H-Carbazol-9-yl)phenylboronic acid is generally considered safe when handled properly. However, ...

Compound Q&A

How should 3-(9H-Carbazol-9-yl)phenylboronic acid (CAS: 864377-33-3) be stored?

3-(9H-Carbazol-9-yl)phenylboronic acid should be stored in a cool, dry place away from light. It is ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...