Compound Q&A

How should 1-Ethyl-3-methyl-1H-imidazol-3-ium acetate (CAS: 143314-17-4) be stored?

Answer

1-Ethyl-3-methyl-1H-imidazol-3-ium acetate
1-Ethyl-3-methyl-1H-imidazol-3-ium acetate (CAS: 143314-17-4) should be stored in a cool, dry place (ideally 25°C) with humidity below 60%. It requires protection from light and should be kept in a sealed, airtight container to prevent contamination or moisture absorption. Store away from incompatible materials and ensure proper ventilation to maintain stability and safety.

About

English Name 1-Ethyl-3-methyl-1H-imidazol-3-ium acetate
Molecular Formula C8H14N2O2
Molecular Weight 170.21 g/mol
SMILES CCN1C=C[N+](=C1)C.CC(=O)[O-]
InChIKey XIYUIMLQTKODPS-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is 1-Ethyl-3-methyl-1H-imidazol-3-ium acetate (CAS: 143314-17-4)?

1-Ethyl-3-methyl-1H-imidazol-3-ium acetate (CAS: 143314-17-4) is an ionic liquid with the chemical f...

Compound Q&A

What are the main uses of 1-Ethyl-3-methyl-1H-imidazol-3-ium acetate (CAS: 143314-17-4)?

1-Ethyl-3-methyl-1H-imidazol-3-ium acetate (CAS: 143314-17-4) is primarily used as a green solvent i...

Compound Q&A

Is 1-Ethyl-3-methyl-1H-imidazol-3-ium acetate (CAS: 143314-17-4) safe?

1-Ethyl-3-methyl-1H-imidazol-3-ium acetate (CAS: 143314-17-4) is generally considered safe when hand...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...