Compound Q&A

What is 1-Ethyl-3-methyl-1H-imidazol-3-ium acetate (CAS: 143314-17-4)?

Answer

1-Ethyl-3-methyl-1H-imidazol-3-ium acetate
1-Ethyl-3-methyl-1H-imidazol-3-ium acetate (CAS: 143314-17-4) is an ionic liquid with the chemical formula C6H10N2O2. It features an imidazolium cation substituted with ethyl and methyl groups, paired with an acetate anion. This compound is known for its thermal stability, non-volatile nature, and ability to dissolve a wide range of substances, making it useful in various chemical processes. Its unique structure contributes to applications in catalysis and material science.

About

English Name 1-Ethyl-3-methyl-1H-imidazol-3-ium acetate
Molecular Formula C8H14N2O2
Molecular Weight 170.21 g/mol
SMILES CCN1C=C[N+](=C1)C.CC(=O)[O-]
InChIKey XIYUIMLQTKODPS-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 1-Ethyl-3-methyl-1H-imidazol-3-ium acetate (CAS: 143314-17-4)?

1-Ethyl-3-methyl-1H-imidazol-3-ium acetate (CAS: 143314-17-4) is primarily used as a green solvent i...

Compound Q&A

Is 1-Ethyl-3-methyl-1H-imidazol-3-ium acetate (CAS: 143314-17-4) safe?

1-Ethyl-3-methyl-1H-imidazol-3-ium acetate (CAS: 143314-17-4) is generally considered safe when hand...

Compound Q&A

How should 1-Ethyl-3-methyl-1H-imidazol-3-ium acetate (CAS: 143314-17-4) be stored?

1-Ethyl-3-methyl-1H-imidazol-3-ium acetate (CAS: 143314-17-4) should be stored in a cool, dry place ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...