Compound Q&A

What are the main uses of 2,4,6-Trimethylbenzoic acid (CAS: 480-63-7)?

Answer

2,4,6-Trimethylbenzoic acid
2,4,6-Trimethylbenzoic acid (CAS: 480-63-7) is used in pharmaceuticals as a precursor for drug synthesis, in industrial applications for the production of dyes and coatings, and in research for studying organic reactions and molecular structures. It may also find applications in food additives and specialty chemical manufacturing.

About

CAS No 480-63-7
English Name 2,4,6-Trimethylbenzoic acid
Molecular Formula C10H12O2
Molecular Weight 164.20399999999998 g/mol
SMILES CC1=CC(=C(C(=C1)C)C(=O)O)C
InChIKey FFFIRKXTFQCCKJ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is 2,4,6-Trimethylbenzoic acid (CAS: 480-63-7)?

2,4,6-Trimethylbenzoic acid (CAS: 480-63-7) is an organic compound with the chemical formula C10H12O...

Compound Q&A

Is 2,4,6-Trimethylbenzoic acid (CAS: 480-63-7) safe?

2,4,6-Trimethylbenzoic acid (CAS: 480-63-7) is generally considered safe in controlled environments,...

Compound Q&A

How should 2,4,6-Trimethylbenzoic acid (CAS: 480-63-7) be stored?

2,4,6-Trimethylbenzoic acid (CAS: 480-63-7) should be stored in a cool, dry, and well-ventilated are...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...