Compound Q&A

What is 2,4,6-Trimethylbenzoic acid (CAS: 480-63-7)?

Answer

2,4,6-Trimethylbenzoic acid
2,4,6-Trimethylbenzoic acid (CAS: 480-63-7) is an organic compound with the chemical formula C10H12O2. It is a substituted benzoic acid containing three methyl groups at the 2, 4, and 6 positions on the benzene ring. This compound is known for its aromatic structure and acidic properties, making it relevant in various chemical applications.

About

CAS No 480-63-7
English Name 2,4,6-Trimethylbenzoic acid
Molecular Formula C10H12O2
Molecular Weight 164.2 g/mol
SMILES CC1=CC(=C(C(=C1)C)C(=O)O)C
InChIKey FFFIRKXTFQCCKJ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 2,4,6-Trimethylbenzoic acid (CAS: 480-63-7)?

2,4,6-Trimethylbenzoic acid (CAS: 480-63-7) is used in pharmaceuticals as a precursor for drug synth...

Compound Q&A

Is 2,4,6-Trimethylbenzoic acid (CAS: 480-63-7) safe?

2,4,6-Trimethylbenzoic acid (CAS: 480-63-7) is generally considered safe in controlled environments,...

Compound Q&A

How should 2,4,6-Trimethylbenzoic acid (CAS: 480-63-7) be stored?

2,4,6-Trimethylbenzoic acid (CAS: 480-63-7) should be stored in a cool, dry, and well-ventilated are...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...