Compound Q&A

What is 2,4,6-Trimethylbenzoic acid (CAS: 480-63-7)?

Answer

2,4,6-Trimethylbenzoic acid
2,4,6-Trimethylbenzoic acid (CAS: 480-63-7) is an organic compound with the chemical formula C10H12O2. It is a substituted benzoic acid containing three methyl groups at the 2, 4, and 6 positions on the benzene ring. This compound is known for its aromatic structure and acidic properties, making it relevant in various chemical applications.

About

CAS No 480-63-7
English Name 2,4,6-Trimethylbenzoic acid
Molecular Formula C10H12O2
Molecular Weight 164.20399999999998 g/mol
SMILES CC1=CC(=C(C(=C1)C)C(=O)O)C
InChIKey FFFIRKXTFQCCKJ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 2,4,6-Trimethylbenzoic acid (CAS: 480-63-7)?

2,4,6-Trimethylbenzoic acid (CAS: 480-63-7) is used in pharmaceuticals as a precursor for drug synth...

Compound Q&A

Is 2,4,6-Trimethylbenzoic acid (CAS: 480-63-7) safe?

2,4,6-Trimethylbenzoic acid (CAS: 480-63-7) is generally considered safe in controlled environments,...

Compound Q&A

How should 2,4,6-Trimethylbenzoic acid (CAS: 480-63-7) be stored?

2,4,6-Trimethylbenzoic acid (CAS: 480-63-7) should be stored in a cool, dry, and well-ventilated are...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...