Compound Q&A

What are the main uses of Cyclopentyl(hydroxy)phenylacetic acid (CAS: 427-49-6)?

Answer

Cyclopentyl(hydroxy)phenylacetic acid
Cyclopentyl(hydroxy)phenylacetic acid (CAS: 427-49-6) is primarily utilized in pharmaceutical research for developing drugs targeting neurological disorders. It serves as a key intermediate in the synthesis of various compounds, including potential antidepressants and antipsychotics. Additionally, it finds applications in organic chemistry for creating complex molecules and in industrial processes requiring functionalized intermediates.

About

CAS No 427-49-6
English Name Cyclopentyl(hydroxy)phenylacetic acid
Molecular Formula C13H16O3
Molecular Weight 220.27 g/mol
SMILES C1CCC(C1)C(C2=CC=CC=C2)(C(=O)O)O
InChIKey WFLUEQCOAQCQLP-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is Cyclopentyl(hydroxy)phenylacetic acid (CAS: 427-49-6)?

Cyclopentyl(hydroxy)phenylacetic acid (CAS: 427-49-6) is a chemical compound with the formula C13H16...

Compound Q&A

Is Cyclopentyl(hydroxy)phenylacetic acid (CAS: 427-49-6) safe?

Cyclopentyl(hydroxy)phenylacetic acid (CAS: 427-49-6) is generally considered safe when handled prop...

Compound Q&A

How should Cyclopentyl(hydroxy)phenylacetic acid (CAS: 427-49-6) be stored?

Cyclopentyl(hydroxy)phenylacetic acid (CAS: 427-49-6) should be stored in a cool, dry place, away fr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...