Compound Q&A

What is Cyclopentyl(hydroxy)phenylacetic acid (CAS: 427-49-6)?

Answer

Cyclopentyl(hydroxy)phenylacetic acid
Cyclopentyl(hydroxy)phenylacetic acid (CAS: 427-49-6) is a chemical compound with the formula C13H16O3. It is a white crystalline solid, known for its hydroxy and cyclopentyl functional groups. This compound exhibits moderate solubility in organic solvents and is commonly used as an intermediate in pharmaceutical and chemical synthesis processes.

About

CAS No 427-49-6
English Name Cyclopentyl(hydroxy)phenylacetic acid
Molecular Formula C13H16O3
Molecular Weight 220.27 g/mol
SMILES C1CCC(C1)C(C2=CC=CC=C2)(C(=O)O)O
InChIKey WFLUEQCOAQCQLP-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of Cyclopentyl(hydroxy)phenylacetic acid (CAS: 427-49-6)?

Cyclopentyl(hydroxy)phenylacetic acid (CAS: 427-49-6) is primarily utilized in pharmaceutical resear...

Compound Q&A

Is Cyclopentyl(hydroxy)phenylacetic acid (CAS: 427-49-6) safe?

Cyclopentyl(hydroxy)phenylacetic acid (CAS: 427-49-6) is generally considered safe when handled prop...

Compound Q&A

How should Cyclopentyl(hydroxy)phenylacetic acid (CAS: 427-49-6) be stored?

Cyclopentyl(hydroxy)phenylacetic acid (CAS: 427-49-6) should be stored in a cool, dry place, away fr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...