Compound Q&A

What are the main uses of DL-Methionine methylsulfonium chloride (CAS: 3493-12-7)?

Answer

DL-Methionine methylsulfonium chloride
DL-Methionine methylsulfonium chloride (CAS: 3493-12-7) is primarily used in pharmaceuticals as a precursor for drug synthesis, in the food industry as a feed additive to enhance nutrient profiles, and in research for organic chemistry reactions involving methylation. It also finds applications in industrial processes for producing sulfide compounds and modifying polymer materials.

About

CAS No 3493-12-7
English Name DL-Methionine methylsulfonium chloride
Molecular Formula C6H14ClNO2S
Molecular Weight 199.7 g/mol
SMILES C[S+](C)CCC(C(=O)O)N.[Cl-]
InChIKey MYGVPKMVGSXPCQ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is DL-Methionine methylsulfonium chloride (CAS: 3493-12-7)?

DL-Methionine methylsulfonium chloride (CAS: 3493-12-7) is a sulfur-containing organic compound with...

Compound Q&A

Is DL-Methionine methylsulfonium chloride (CAS: 3493-12-7) safe?

DL-Methionine methylsulfonium chloride (CAS: 3493-12-7) requires careful handling due to its potenti...

Compound Q&A

How should DL-Methionine methylsulfonium chloride (CAS: 3493-12-7) be stored?

DL-Methionine methylsulfonium chloride (CAS: 3493-12-7) should be stored in a cool, dry, and dark pl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...