Compound Q&A

What is DL-Methionine methylsulfonium chloride (CAS: 3493-12-7)?

Answer

DL-Methionine methylsulfonium chloride
DL-Methionine methylsulfonium chloride (CAS: 3493-12-7) is a sulfur-containing organic compound with the chemical formula C5H11NO2S2Cl. It is a white crystalline solid, commonly used as a methylating agent in chemical synthesis. The compound exhibits moderate solubility in water and is characterized by its role in functionalizing molecules through sulfonium group reactions, making it valuable in pharmaceutical and industrial applications.

About

CAS No 3493-12-7
English Name DL-Methionine methylsulfonium chloride
Molecular Formula C6H14ClNO2S
Molecular Weight 199.7 g/mol
SMILES C[S+](C)CCC(C(=O)O)N.[Cl-]
InChIKey MYGVPKMVGSXPCQ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of DL-Methionine methylsulfonium chloride (CAS: 3493-12-7)?

DL-Methionine methylsulfonium chloride (CAS: 3493-12-7) is primarily used in pharmaceuticals as a pr...

Compound Q&A

Is DL-Methionine methylsulfonium chloride (CAS: 3493-12-7) safe?

DL-Methionine methylsulfonium chloride (CAS: 3493-12-7) requires careful handling due to its potenti...

Compound Q&A

How should DL-Methionine methylsulfonium chloride (CAS: 3493-12-7) be stored?

DL-Methionine methylsulfonium chloride (CAS: 3493-12-7) should be stored in a cool, dry, and dark pl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...