Compound Q&A

What are the main uses of N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-2-pyrimidinamine (CAS: 152460-09-8)?

Answer

N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-2-pyrimidinamine
N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-2-pyrimidinamine (CAS: 152460-09-8) is primarily used in pharmaceutical research as a potential lead compound for drug development. It may serve as an inhibitor of certain enzymes or have antifungal properties. Additionally, it is used in the synthesis of other organic compounds and in chemical studies related to molecular structure and reactivity.

About

English Name N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-2-pyrimidinamine
Molecular Formula C16H13N5O2
Molecular Weight 307.31 g/mol
SMILES CC1=C(C=C(C=C1)[N+](=O)[O-])NC2=NC=CC(=N2)C3=CN=CC=C3
InChIKey OJITWRFPRCHSMX-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-2-pyrimidinamine (CAS: 152460-09-8)?

N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-2-pyrimidinamine, with CAS number 152460-09-8, is a synth...

Compound Q&A

Is N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-2-pyrimidinamine (CAS: 152460-09-8) safe?

N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-2-pyrimidinamine (CAS: 152460-09-8) is generally consider...

Compound Q&A

How should N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-2-pyrimidinamine (CAS: 152460-09-8) be stored?

N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-2-pyrimidinamine (CAS: 152460-09-8) should be stored in a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...