Compound Q&A

What is N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-2-pyrimidinamine (CAS: 152460-09-8)?

Answer

N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-2-pyrimidinamine
N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-2-pyrimidinamine, with CAS number 152460-09-8, is a synthetic organic compound characterized by its pyrimidine and pyridine ring structures. It is typically a solid at room temperature and exhibits moderate solubility in organic solvents. This compound is known for its potential applications in medicinal chemistry due to its ability to interact with biological targets.

About

English Name N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-2-pyrimidinamine
Molecular Formula C16H13N5O2
Molecular Weight 307.31 g/mol
SMILES CC1=C(C=C(C=C1)[N+](=O)[O-])NC2=NC=CC(=N2)C3=CN=CC=C3
InChIKey OJITWRFPRCHSMX-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-2-pyrimidinamine (CAS: 152460-09-8)?

N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-2-pyrimidinamine (CAS: 152460-09-8) is primarily used in ...

Compound Q&A

Is N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-2-pyrimidinamine (CAS: 152460-09-8) safe?

N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-2-pyrimidinamine (CAS: 152460-09-8) is generally consider...

Compound Q&A

How should N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-2-pyrimidinamine (CAS: 152460-09-8) be stored?

N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-2-pyrimidinamine (CAS: 152460-09-8) should be stored in a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...