Compound Q&A

What is 2-(5-Methoxy-1H-indol-3-yl)ethanamine hydrochloride (CAS: 66-83-1)?

Answer

2-(5-Methoxy-1H-indol-3-yl)ethanamine hydrochloride (1:1)
2-(5-Methoxy-1H-indol-3-yl)ethanamine hydrochloride (CAS: 66-83-1) is a chemical compound commonly used in pharmaceutical research. Its chemical formula is C12H15NO2·HCl, and it is a white to pale yellow solid with a molecular weight of approximately 259.7 g/mol. The compound is known for its solubility in water and is often used as a building block in the synthesis of various pharmaceutical agents.

About

CAS No 66-83-1
English Name 2-(5-Methoxy-1H-indol-3-yl)ethanamine hydrochloride (1:1)
Molecular Formula C11H15ClN2O
Molecular Weight 226.7 g/mol
SMILES COC1=CC2=C(C=C1)NC=C2CCN.Cl
InChIKey TXVAYRSEKRMEIF-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 2-(5-Methoxy-1H-indol-3-yl)ethanamine hydrochloride (CAS: 66-83-1)?

2-(5-Methoxy-1H-indol-3-yl)ethanamine hydrochloride (CAS: 66-83-1) is primarily used in pharmaceutic...

Compound Q&A

Is 2-(5-Methoxy-1H-indol-3-yl)ethanamine hydrochloride (CAS: 66-83-1) safe?

2-(5-Methoxy-1H-indol-3-yl)ethanamine hydrochloride (CAS: 66-83-1) is generally considered safe when...

Compound Q&A

How should 2-(5-Methoxy-1H-indol-3-yl)ethanamine hydrochloride (CAS: 66-83-1) be stored?

2-(5-Methoxy-1H-indol-3-yl)ethanamine hydrochloride (CAS: 66-83-1) should be stored in a cool, dry, ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...