Compound Q&A

What are the main uses of 2-(naphthalen-2-yloxy)acetic acid (CAS: 120-23-0)?

Answer

2-(naphthalen-2-yloxy)acetic acid
2-(naphthalen-2-yloxy)acetic acid (CAS: 120-23-0) is primarily used as a pesticide and herbicide in agricultural formulations. It also serves as a key intermediate in the synthesis of pharmaceuticals and dyes. In research, it is employed for developing new chemical compounds and studying reaction mechanisms. Its applications span across industry, agriculture, and scientific research due to its functional groups and structural stability.

About

CAS No 120-23-0
English Name 2-(naphthalen-2-yloxy)acetic acid
Molecular Formula C12H10O3
Molecular Weight 202.21 g/mol
SMILES C1=CC=C2C=C(C=CC2=C1)OCC(=O)O
InChIKey RZCJYMOBWVJQGV-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is 2-(naphthalen-2-yloxy)acetic acid (CAS: 120-23-0)?

2-(naphthalen-2-yloxy)acetic acid (CAS: 120-23-0) is an organic compound with the chemical formula C...

Compound Q&A

Is 2-(naphthalen-2-yloxy)acetic acid (CAS: 120-23-0) safe?

2-(naphthalen-2-yloxy)acetic acid (CAS: 120-23-0) is considered hazardous and requires careful handl...

Compound Q&A

How should 2-(naphthalen-2-yloxy)acetic acid (CAS: 120-23-0) be stored?

2-(naphthalen-2-yloxy)acetic acid (CAS: 120-23-0) should be stored in a cool, dry place (ideally 2-8...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...