Compound Q&A

What is 2-(naphthalen-2-yloxy)acetic acid (CAS: 120-23-0)?

Answer

2-(naphthalen-2-yloxy)acetic acid
2-(naphthalen-2-yloxy)acetic acid (CAS: 120-23-0) is an organic compound with the chemical formula C12H12O3. It features a naphthalene ring connected to an acetic acid group via an oxygen bridge, making it a versatile intermediate in chemical synthesis. The compound is typically a white solid with moderate solubility in organic solvents and is used in various industrial and research applications due to its unique structure and reactivity.

About

CAS No 120-23-0
English Name 2-(naphthalen-2-yloxy)acetic acid
Molecular Formula C12H10O3
Molecular Weight 202.209 g/mol
SMILES C1=CC=C2C=C(C=CC2=C1)OCC(=O)O
InChIKey RZCJYMOBWVJQGV-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 2-(naphthalen-2-yloxy)acetic acid (CAS: 120-23-0)?

2-(naphthalen-2-yloxy)acetic acid (CAS: 120-23-0) is primarily used as a pesticide and herbicide in ...

Compound Q&A

Is 2-(naphthalen-2-yloxy)acetic acid (CAS: 120-23-0) safe?

2-(naphthalen-2-yloxy)acetic acid (CAS: 120-23-0) is considered hazardous and requires careful handl...

Compound Q&A

How should 2-(naphthalen-2-yloxy)acetic acid (CAS: 120-23-0) be stored?

2-(naphthalen-2-yloxy)acetic acid (CAS: 120-23-0) should be stored in a cool, dry place (ideally 2-8...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...