Compound Q&A

What is 2-(naphthalen-2-yloxy)acetic acid (CAS: 120-23-0)?

Answer

2-(naphthalen-2-yloxy)acetic acid
2-(naphthalen-2-yloxy)acetic acid (CAS: 120-23-0) is an organic compound with the chemical formula C12H12O3. It features a naphthalene ring connected to an acetic acid group via an oxygen bridge, making it a versatile intermediate in chemical synthesis. The compound is typically a white solid with moderate solubility in organic solvents and is used in various industrial and research applications due to its unique structure and reactivity.

About

CAS No 120-23-0
English Name 2-(naphthalen-2-yloxy)acetic acid
Molecular Formula C12H10O3
Molecular Weight 202.21 g/mol
SMILES C1=CC=C2C=C(C=CC2=C1)OCC(=O)O
InChIKey RZCJYMOBWVJQGV-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 2-(naphthalen-2-yloxy)acetic acid (CAS: 120-23-0)?

2-(naphthalen-2-yloxy)acetic acid (CAS: 120-23-0) is primarily used as a pesticide and herbicide in ...

Compound Q&A

Is 2-(naphthalen-2-yloxy)acetic acid (CAS: 120-23-0) safe?

2-(naphthalen-2-yloxy)acetic acid (CAS: 120-23-0) is considered hazardous and requires careful handl...

Compound Q&A

How should 2-(naphthalen-2-yloxy)acetic acid (CAS: 120-23-0) be stored?

2-(naphthalen-2-yloxy)acetic acid (CAS: 120-23-0) should be stored in a cool, dry place (ideally 2-8...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...