Compound Q&A

What is S-(Acetamidomethyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-cysteine (CAS: 86060-81-3)?

Answer

S-(Acetamidomethyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-cysteine
S-(Acetamidomethyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-cysteine is a derivative of L-cysteine, commonly used in peptide chemistry. It has the CAS number 86060-81-3 and contains a fluorenylmethoxy carbonyl (Fmoc) protecting group. This compound is known for its stability and utility in solid-phase peptide synthesis. Its molecular formula is C19H27N3O5S, and it typically appears as a white to off-white solid with a high melting point.

About

CAS No 86060-81-3
English Name S-(Acetamidomethyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-cysteine
Molecular Formula C21H22N2O5S
Molecular Weight 414.48 g/mol
SMILES CC(=O)NCSC[C@H](NC(=O)OCC1c2ccccc2-c3ccccc13)C(=O)O
InChIKey CSMYOORPUGPKAP-IBGZPJMESA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of S-(Acetamidomethyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-cysteine (CAS: 86060-81-3)?

S-(Acetamidomethyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-cysteine (CAS: 86060-81-3) is primarily u...

Compound Q&A

Is S-(Acetamidomethyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-cysteine (CAS: 86060-81-3) safe?

S-(Acetamidomethyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-cysteine (CAS: 86060-81-3) is generally c...

Compound Q&A

How should S-(Acetamidomethyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-cysteine (CAS: 86060-81-3) be stored?

S-(Acetamidomethyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-cysteine (CAS: 86060-81-3) should be stor...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...