Compound Q&A

What are the main uses of N-Hydroxysulfosuccinimide sodium (CAS: 106627-54-7)?

Answer

N-Hydroxysulfosuccinimide sodium
N-Hydroxysulfosuccinimide sodium is primarily used in pharmaceutical research for the synthesis of drug molecules, particularly in the production of proteins and peptides. It also finds applications in industrial chemical processes, biotechnology, and as a coupling agent in bioconjugation. Its role in functionalizing biomolecules makes it valuable in research and development of therapeutic agents and diagnostic tools.

About

English Name N-Hydroxysulfosuccinimide sodium
Molecular Formula C4H4NNaO6S
Molecular Weight 217.13 g/mol
SMILES C1C(C(=O)N(C1=O)O)S(=O)(=O)[O-].[Na+]
InChIKey RPENMORRBUTCPR-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is N-Hydroxysulfosuccinimide sodium (CAS: 106627-54-7)?

N-Hydroxysulfosuccinimide sodium, with the CAS number 106627-54-7, is a sodium salt of N-hydroxysulf...

Compound Q&A

Is N-Hydroxysulfosuccinimide sodium (CAS: 106627-54-7) safe?

N-Hydroxysulfosuccinimide sodium is generally considered safe when handled properly. However, it sho...

Compound Q&A

How should N-Hydroxysulfosuccinimide sodium (CAS: 106627-54-7) be stored?

N-Hydroxysulfosuccinimide sodium should be stored in a cool, dry place away from light. It is recomm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...