Compound Q&A

What is N-Hydroxysulfosuccinimide sodium (CAS: 106627-54-7)?

Answer

N-Hydroxysulfosuccinimide sodium
N-Hydroxysulfosuccinimide sodium, with the CAS number 106627-54-7, is a sodium salt of N-hydroxysulfosuccinimide. It is a white crystalline solid that is commonly used as a reagent in chemical synthesis. It is known for its reactivity and is often employed in conjugation reactions due to its ability to form stable amide bonds. The compound has a molecular formula of C4H6NaO5S2 and is soluble in water.

About

English Name N-Hydroxysulfosuccinimide sodium
Molecular Formula C4H4NNaO6S
Molecular Weight 217.13 g/mol
SMILES C1C(C(=O)N(C1=O)O)S(=O)(=O)[O-].[Na+]
InChIKey RPENMORRBUTCPR-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of N-Hydroxysulfosuccinimide sodium (CAS: 106627-54-7)?

N-Hydroxysulfosuccinimide sodium is primarily used in pharmaceutical research for the synthesis of d...

Compound Q&A

Is N-Hydroxysulfosuccinimide sodium (CAS: 106627-54-7) safe?

N-Hydroxysulfosuccinimide sodium is generally considered safe when handled properly. However, it sho...

Compound Q&A

How should N-Hydroxysulfosuccinimide sodium (CAS: 106627-54-7) be stored?

N-Hydroxysulfosuccinimide sodium should be stored in a cool, dry place away from light. It is recomm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...