Compound Q&A

What are the main uses of Tetrabenzyl diphosphate (CAS: 990-91-0)?

Answer

Tetrabenzyl diphosphate
Tetrabenzyl diphosphate is primarily used in pharmaceutical research as a precursor for the synthesis of various organic compounds. It also finds applications in industrial chemistry for producing intermediates in drug development and specialty chemicals. Its utility in research settings is due to its ability to participate in multiple reaction pathways. CAS number 990-91-0 identifies this compound in chemical databases.

About

CAS No 990-91-0
English Name Tetrabenzyl diphosphate
Molecular Formula C28H28O7P2
Molecular Weight 538.47 g/mol
SMILES C1=CC=C(C=C1)COP(=O)(OCC2=CC=CC=C2)OP(=O)(OCC3=CC=CC=C3)OCC4=CC=CC=C4
InChIKey NSBNXCZCLRBQTA-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is Tetrabenzyl diphosphate (CAS: 990-91-0)?

Tetrabenzyl diphosphate is a chemical compound with the formula C24H24O5P2. It is characterized by i...

Compound Q&A

Is Tetrabenzyl diphosphate (CAS: 990-91-0) safe?

Tetrabenzyl diphosphate is generally considered safe when handled properly, but it should be treated...

Compound Q&A

How should Tetrabenzyl diphosphate (CAS: 990-91-0) be stored?

Tetrabenzyl diphosphate should be stored in a cool, dry, and dark place, ideally at temperatures bel...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...