Compound Q&A

What is Tetrabenzyl diphosphate (CAS: 990-91-0)?

Answer

Tetrabenzyl diphosphate
Tetrabenzyl diphosphate is a chemical compound with the formula C24H24O5P2. It is characterized by its structure, which includes four benzyl groups connected to a diphosphate core. This compound is known for its stability and is commonly used as a reagent in organic synthesis due to its unique reactivity and functional group versatility. Its CAS number is 990-91-0.

About

CAS No 990-91-0
English Name Tetrabenzyl diphosphate
Molecular Formula C28H28O7P2
Molecular Weight 538.47 g/mol
SMILES C1=CC=C(C=C1)COP(=O)(OCC2=CC=CC=C2)OP(=O)(OCC3=CC=CC=C3)OCC4=CC=CC=C4
InChIKey NSBNXCZCLRBQTA-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of Tetrabenzyl diphosphate (CAS: 990-91-0)?

Tetrabenzyl diphosphate is primarily used in pharmaceutical research as a precursor for the synthesi...

Compound Q&A

Is Tetrabenzyl diphosphate (CAS: 990-91-0) safe?

Tetrabenzyl diphosphate is generally considered safe when handled properly, but it should be treated...

Compound Q&A

How should Tetrabenzyl diphosphate (CAS: 990-91-0) be stored?

Tetrabenzyl diphosphate should be stored in a cool, dry, and dark place, ideally at temperatures bel...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...