Compound Q&A

What are the main uses of 2-Methyl-4-nitrobenzoic acid (CAS: 1975-51-5)?

Answer

2-Methyl-4-nitrobenzoic acid
2-Methyl-4-nitrobenzoic acid (CAS: 1975-51-5) is primarily used in pharmaceutical research for the development of drugs and as an intermediate in the synthesis of various organic compounds. It also finds applications in the production of dyes, pigments, and other chemicals. Its unique structure makes it valuable in chemical research and industrial processes involving functional group modification.

About

CAS No 1975-51-5
English Name 2-Methyl-4-nitrobenzoic acid
Molecular Formula C8H7NO4
Molecular Weight 181.15 g/mol
SMILES CC1=C(C=CC(=C1)[N+](=O)[O-])C(=O)O
InChIKey XXXOBNJIIZQSPT-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is 2-Methyl-4-nitrobenzoic acid (CAS: 1975-51-5)?

2-Methyl-4-nitrobenzoic acid (CAS: 1975-51-5) is an aromatic carboxylic acid with a methyl group and...

Compound Q&A

Is 2-Methyl-4-nitrobenzoic acid (CAS: 1975-51-5) safe?

2-Methyl-4-nitrobenzoic acid (CAS: 1975-51-5) is generally considered safe when handled properly, bu...

Compound Q&A

How should 2-Methyl-4-nitrobenzoic acid (CAS: 1975-51-5) be stored?

2-Methyl-4-nitrobenzoic acid (CAS: 1975-51-5) should be stored in a cool, dry, and dark place to mai...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...